About 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine
2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine (PubChem CID 63480563) has the molecular formula C15H19FN2
and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine |
| PubChem CID | 63480563 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine |
| SMILES | CNc1cc(C(C)(C)C)nc2c(F)ccc(C)c12 |
| InChI | InChI=1S/C15H19FN2/c1-9-6-7-10(16)14-13(9)11(17-5)8-12(18-14)15(2,3)4/h6-8H,1-5H3,(H,17,18) |
| InChIKey | RTSAEIVKFHCNKY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine?
The IUPAC name of 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine (CID 63480563) is 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine.
What is the SMILES notation for 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine?
The canonical SMILES for 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine is CNc1cc(C(C)(C)C)nc2c(F)ccc(C)c12.
What is the InChIKey of 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine?
The InChIKey is RTSAEIVKFHCNKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2/c1-9-6-7-10(16)14-13(9)11(17-5)8-12(18-14)15(2,3)4/h6-8H,1-5H3,(H,17,18).
What are the key properties of 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine?
2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine has a molecular weight of 246.33 g/mol, XLogP of 4.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-8-fluoro-N,5-dimethylquinolin-4-amine is sourced from PubChem (CID 63480563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).