C15H17Cl2N3 — CID 63480830
6-tert-butyl-2-(2,6-dichlorophenyl)-N-methylpyrimidin-4-amine (PubChem CID 63480830) has the molecular formula C15H17Cl2N3 and a molecular weight of 310.23 g/mol. Its IUPAC name is 6-tert-butyl-2-(2,6-dichlorophenyl)-N-methylpyrimidin-4-amine.
| Compound Name | 6-tert-butyl-2-(2,6-dichlorophenyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63480830 |
| Molecular Formula | C15H17Cl2N3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 6-tert-butyl-2-(2,6-dichlorophenyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(C(C)(C)C)nc(-c2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C15H17Cl2N3/c1-15(2,3)11-8-12(18-4)20-14(19-11)13-9(16)6-5-7-10(13)17/h5-8H,1-4H3,(H,18,19,20) |
| InChIKey | RKUMSODJOHLPHW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |