C11H13N7S2 — CID 63482049
[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 63482049) has the molecular formula C11H13N7S2 and a molecular weight of 307.41 g/mol. Its IUPAC name is [2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63482049 |
| Molecular Formula | C11H13N7S2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nnc(SCc2nc(NN)c3ccsc3n2)n1C |
| InChI | InChI=1S/C11H13N7S2/c1-6-16-17-11(18(6)2)20-5-8-13-9(15-12)7-3-4-19-10(7)14-8/h3-4H,5,12H2,1-2H3,(H,13,14,15) |
| InChIKey | DNWZZDRHOQPGBV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|