C19H34N2 — CID 63482320
2-methyl-2-phenyl-N,N,N'-tripropylpropane-1,3-diamine (PubChem CID 63482320) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 2-methyl-2-phenyl-N,N,N'-tripropylpropane-1,3-diamine.
| Compound Name | 2-methyl-2-phenyl-N,N,N'-tripropylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63482320 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 2-methyl-2-phenyl-N,N,N'-tripropylpropane-1,3-diamine |
| SMILES | CCCNCC(C)(CN(CCC)CCC)c1ccccc1 |
| InChI | InChI=1S/C19H34N2/c1-5-13-20-16-19(4,18-11-9-8-10-12-18)17-21(14-6-2)15-7-3/h8-12,20H,5-7,13-17H2,1-4H3 |
| InChIKey | JPBBAQZZMZPFAL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|