C17H22N4 — CID 63482428
[2-(2,5-dimethylphenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine (PubChem CID 63482428) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2,5-dimethylphenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63482428 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1ccc(C)c(-c2nc3c(c(NN)n2)CCCCC3)c1 |
| InChI | InChI=1S/C17H22N4/c1-11-8-9-12(2)14(10-11)16-19-15-7-5-3-4-6-13(15)17(20-16)21-18/h8-10H,3-7,18H2,1-2H3,(H,19,20,21) |
| InChIKey | MJPKUEGKKLHBCW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|