C19H34N2 — CID 63482896
N',N'-dibutyl-N-methyl-1-(4-methylphenyl)propane-1,3-diamine (PubChem CID 63482896) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is N',N'-dibutyl-N-methyl-1-(4-methylphenyl)propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-methyl-1-(4-methylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 63482896 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | N',N'-dibutyl-N-methyl-1-(4-methylphenyl)propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCC(NC)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H34N2/c1-5-7-14-21(15-8-6-2)16-13-19(20-4)18-11-9-17(3)10-12-18/h9-12,19-20H,5-8,13-16H2,1-4H3 |
| InChIKey | BPNMNLUHKNEYMV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |