About [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine
[1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine (PubChem CID 63484142) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine |
| PubChem CID | 63484142 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine |
| SMILES | Cc1ccc2c(c1)CCCN2CC1(CN)CCCCC1 |
| InChI | InChI=1S/C18H28N2/c1-15-7-8-17-16(12-15)6-5-11-20(17)14-18(13-19)9-3-2-4-10-18/h7-8,12H,2-6,9-11,13-14,19H2,1H3 |
| InChIKey | AFJJQXXSGSTXSB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine?
The IUPAC name of [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine (CID 63484142) is [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine.
What is the SMILES notation for [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine?
The canonical SMILES for [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine is Cc1ccc2c(c1)CCCN2CC1(CN)CCCCC1.
What is the InChIKey of [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine?
The InChIKey is AFJJQXXSGSTXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2/c1-15-7-8-17-16(12-15)6-5-11-20(17)14-18(13-19)9-3-2-4-10-18/h7-8,12H,2-6,9-11,13-14,19H2,1H3.
What are the key properties of [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine?
[1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine has a molecular weight of 272.44 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]cyclohexyl]methanamine is sourced from PubChem (CID 63484142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).