C16H21N3 — CID 63484235
(7-propyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine (PubChem CID 63484235) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (7-propyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine.
| Compound Name | (7-propyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
|---|---|
| PubChem CID | 63484235 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (7-propyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
| SMILES | CCCc1ccc2nc3c(c(NN)c2c1)CCCC3 |
| InChI | InChI=1S/C16H21N3/c1-2-5-11-8-9-15-13(10-11)16(19-17)12-6-3-4-7-14(12)18-15/h8-10H,2-7,17H2,1H3,(H,18,19) |
| InChIKey | XDZSAUIXPGEOPW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|