About 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine
5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine (PubChem CID 63484955) has the molecular formula C17H21ClN2O
and a molecular weight of 304.82 g/mol. Its IUPAC name is 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine |
| PubChem CID | 63484955 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine |
| SMILES | CCNc1ccc(Cl)c(COc2cc(C)cc(C)c2C)n1 |
| InChI | InChI=1S/C17H21ClN2O/c1-5-19-17-7-6-14(18)15(20-17)10-21-16-9-11(2)8-12(3)13(16)4/h6-9H,5,10H2,1-4H3,(H,19,20) |
| InChIKey | HMUHCLJIJYEADI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine?
The IUPAC name of 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine (CID 63484955) is 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine.
What is the SMILES notation for 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine?
The canonical SMILES for 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine is CCNc1ccc(Cl)c(COc2cc(C)cc(C)c2C)n1.
What is the InChIKey of 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine?
The InChIKey is HMUHCLJIJYEADI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2O/c1-5-19-17-7-6-14(18)15(20-17)10-21-16-9-11(2)8-12(3)13(16)4/h6-9H,5,10H2,1-4H3,(H,19,20).
What are the key properties of 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine?
5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine has a molecular weight of 304.82 g/mol, XLogP of 4.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-ethyl-6-[(2,3,5-trimethylphenoxy)methyl]pyridin-2-amine is sourced from PubChem (CID 63484955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).