C17H22FN3 — CID 63485042
2-[(2-fluorophenyl)methyl]-N,6-dipropylpyrimidin-4-amine (PubChem CID 63485042) has the molecular formula C17H22FN3 and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-N,6-dipropylpyrimidin-4-amine.
| Compound Name | 2-[(2-fluorophenyl)methyl]-N,6-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63485042 |
| Molecular Formula | C17H22FN3 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-N,6-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1cc(CCC)nc(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C17H22FN3/c1-3-7-14-12-16(19-10-4-2)21-17(20-14)11-13-8-5-6-9-15(13)18/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | WIPPEMUABBNSNN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |