C16H19BrClNOS — CID 63486006
N-[[4-[(4-bromothiophen-2-yl)methoxy]-3-chlorophenyl]methyl]-2-methylpropan-1-amine (PubChem CID 63486006) has the molecular formula C16H19BrClNOS and a molecular weight of 388.76 g/mol. Its IUPAC name is N-[[4-[(4-bromothiophen-2-yl)methoxy]-3-chlorophenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[4-[(4-bromothiophen-2-yl)methoxy]-3-chlorophenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 63486006 |
| Molecular Formula | C16H19BrClNOS |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | N-[[4-[(4-bromothiophen-2-yl)methoxy]-3-chlorophenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccc(OCc2cc(Br)cs2)c(Cl)c1 |
| InChI | InChI=1S/C16H19BrClNOS/c1-11(2)7-19-8-12-3-4-16(15(18)5-12)20-9-14-6-13(17)10-21-14/h3-6,10-11,19H,7-9H2,1-2H3 |
| InChIKey | MDVVGONFIFZAQI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |