C16H20BrNOS — CID 63486928
N-[[2-[(4-bromothiophen-2-yl)methoxy]-5-methylphenyl]methyl]propan-2-amine (PubChem CID 63486928) has the molecular formula C16H20BrNOS and a molecular weight of 354.31 g/mol. Its IUPAC name is N-[[2-[(4-bromothiophen-2-yl)methoxy]-5-methylphenyl]methyl]propan-2-amine.
| Compound Name | N-[[2-[(4-bromothiophen-2-yl)methoxy]-5-methylphenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 63486928 |
| Molecular Formula | C16H20BrNOS |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[[2-[(4-bromothiophen-2-yl)methoxy]-5-methylphenyl]methyl]propan-2-amine |
| SMILES | Cc1ccc(OCc2cc(Br)cs2)c(CNC(C)C)c1 |
| InChI | InChI=1S/C16H20BrNOS/c1-11(2)18-8-13-6-12(3)4-5-16(13)19-9-15-7-14(17)10-20-15/h4-7,10-11,18H,8-9H2,1-3H3 |
| InChIKey | XTIFXFALYYBXHS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |