C12H9Cl3O3 — CID 63487677
4,5,7-trichloro-3-propyl-1-benzofuran-2-carboxylic acid (PubChem CID 63487677) has the molecular formula C12H9Cl3O3 and a molecular weight of 307.56 g/mol. Its IUPAC name is 4,5,7-trichloro-3-propyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 4,5,7-trichloro-3-propyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63487677 |
| Molecular Formula | C12H9Cl3O3 |
| Molecular Weight | 307.56 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 4,5,7-trichloro-3-propyl-1-benzofuran-2-carboxylic acid |
| SMILES | CCCc1c(C(=O)O)oc2c(Cl)cc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C12H9Cl3O3/c1-2-3-5-8-9(15)6(13)4-7(14)11(8)18-10(5)12(16)17/h4H,2-3H2,1H3,(H,16,17) |
| InChIKey | JGKVMFLSBGACOF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|