C11H11Cl3F3NO — CID 63487839
2,4,6-trichloro-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline (PubChem CID 63487839) has the molecular formula C11H11Cl3F3NO and a molecular weight of 336.57 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline |
|---|---|
| PubChem CID | 63487839 |
| Molecular Formula | C11H11Cl3F3NO |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 2,4,6-trichloro-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline |
| SMILES | FC(F)(F)COCCCNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl3F3NO/c12-7-4-8(13)10(9(14)5-7)18-2-1-3-19-6-11(15,16)17/h4-5,18H,1-3,6H2 |
| InChIKey | ARWRTPOVYBXBHK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|