C14H11BrCl3NO — CID 63487848
1-(3-bromophenyl)-2-(2,4,6-trichloroanilino)ethanol (PubChem CID 63487848) has the molecular formula C14H11BrCl3NO and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(2,4,6-trichloroanilino)ethanol.
| Compound Name | 1-(3-bromophenyl)-2-(2,4,6-trichloroanilino)ethanol |
|---|---|
| PubChem CID | 63487848 |
| Molecular Formula | C14H11BrCl3NO |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | 1-(3-bromophenyl)-2-(2,4,6-trichloroanilino)ethanol |
| SMILES | OC(CNc1c(Cl)cc(Cl)cc1Cl)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H11BrCl3NO/c15-9-3-1-2-8(4-9)13(20)7-19-14-11(17)5-10(16)6-12(14)18/h1-6,13,19-20H,7H2 |
| InChIKey | IIWHDOCPMUCACV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |