C14H17ClF3NO — CID 63487992
2-[2-chloro-6-(trifluoromethyl)anilino]cycloheptan-1-ol (PubChem CID 63487992) has the molecular formula C14H17ClF3NO and a molecular weight of 307.74 g/mol. Its IUPAC name is 2-[2-chloro-6-(trifluoromethyl)anilino]cycloheptan-1-ol.
| Compound Name | 2-[2-chloro-6-(trifluoromethyl)anilino]cycloheptan-1-ol |
|---|---|
| PubChem CID | 63487992 |
| Molecular Formula | C14H17ClF3NO |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[2-chloro-6-(trifluoromethyl)anilino]cycloheptan-1-ol |
| SMILES | OC1CCCCCC1Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H17ClF3NO/c15-10-6-4-5-9(14(16,17)18)13(10)19-11-7-2-1-3-8-12(11)20/h4-6,11-12,19-20H,1-3,7-8H2 |
| InChIKey | NPYSVITUZAKWCC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |