About 5,7-ditert-butyl-2-chloro-1,3-benzoxazole
5,7-ditert-butyl-2-chloro-1,3-benzoxazole (PubChem CID 63488344) has the molecular formula C15H20ClNO
and a molecular weight of 265.78 g/mol. Its IUPAC name is 5,7-ditert-butyl-2-chloro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5,7-ditert-butyl-2-chloro-1,3-benzoxazole |
| PubChem CID | 63488344 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 5,7-ditert-butyl-2-chloro-1,3-benzoxazole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(Cl)nc2c1 |
| InChI | InChI=1S/C15H20ClNO/c1-14(2,3)9-7-10(15(4,5)6)12-11(8-9)17-13(16)18-12/h7-8H,1-6H3 |
| InChIKey | ZKAZWSHGBHZJJF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-ditert-butyl-2-chloro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-ditert-butyl-2-chloro-1,3-benzoxazole?
The IUPAC name of 5,7-ditert-butyl-2-chloro-1,3-benzoxazole (CID 63488344) is 5,7-ditert-butyl-2-chloro-1,3-benzoxazole.
What is the SMILES notation for 5,7-ditert-butyl-2-chloro-1,3-benzoxazole?
The canonical SMILES for 5,7-ditert-butyl-2-chloro-1,3-benzoxazole is CC(C)(C)c1cc(C(C)(C)C)c2oc(Cl)nc2c1.
What is the InChIKey of 5,7-ditert-butyl-2-chloro-1,3-benzoxazole?
The InChIKey is ZKAZWSHGBHZJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClNO/c1-14(2,3)9-7-10(15(4,5)6)12-11(8-9)17-13(16)18-12/h7-8H,1-6H3.
What are the key properties of 5,7-ditert-butyl-2-chloro-1,3-benzoxazole?
5,7-ditert-butyl-2-chloro-1,3-benzoxazole has a molecular weight of 265.78 g/mol, XLogP of 5.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-ditert-butyl-2-chloro-1,3-benzoxazole is sourced from PubChem (CID 63488344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).