C27H30BrN3O2 — CID 6348923
methyl 2-[(2R,4R)-6-bromo-2-[4-(diethylamino)phenyl]-4-phenyl-2,4-dihydro-1H-quinazolin-3-yl]acetate (PubChem CID 6348923) has the molecular formula C27H30BrN3O2 and a molecular weight of 508.46 g/mol. Its IUPAC name is methyl 2-[(2R,4R)-6-bromo-2-[4-(diethylamino)phenyl]-4-phenyl-2,4-dihydro-1H-quinazolin-3-yl]acetate.
| Compound Name | methyl 2-[(2R,4R)-6-bromo-2-[4-(diethylamino)phenyl]-4-phenyl-2,4-dihydro-1H-quinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 6348923 |
| Molecular Formula | C27H30BrN3O2 |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | methyl 2-[(2R,4R)-6-bromo-2-[4-(diethylamino)phenyl]-4-phenyl-2,4-dihydro-1H-quinazolin-3-yl]acetate |
| SMILES | CCN(CC)c1ccc([C@@H]2Nc3ccc(Br)cc3[C@@H](c3ccccc3)N2CC(=O)OC)cc1 |
| InChI | InChI=1S/C27H30BrN3O2/c1-4-30(5-2)22-14-11-20(12-15-22)27-29-24-16-13-21(28)17-23(24)26(19-9-7-6-8-10-19)31(27)18-25(32)33-3/h6-17,26-27,29H,4-5,18H2,1-3H3/t26-,27-/m1/s1 |
| InChIKey | JEWBHOYZNPPTKZ-KAYWLYCHSA-N |
| XLogP | 5.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|