C15H15BrCl2N2O — CID 63489529
N-[[6-(2-bromo-4-chlorophenoxy)-3-chloro-2-pyridinyl]methyl]propan-1-amine (PubChem CID 63489529) has the molecular formula C15H15BrCl2N2O and a molecular weight of 390.11 g/mol. Its IUPAC name is N-[[6-(2-bromo-4-chlorophenoxy)-3-chloro-2-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-(2-bromo-4-chlorophenoxy)-3-chloro-2-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63489529 |
| Molecular Formula | C15H15BrCl2N2O |
| Molecular Weight | 390.11 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | N-[[6-(2-bromo-4-chlorophenoxy)-3-chloro-2-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1nc(Oc2ccc(Cl)cc2Br)ccc1Cl |
| InChI | InChI=1S/C15H15BrCl2N2O/c1-2-7-19-9-13-12(18)4-6-15(20-13)21-14-5-3-10(17)8-11(14)16/h3-6,8,19H,2,7,9H2,1H3 |
| InChIKey | DYVMISYMTFKOEI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.11 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|