C16H28ClN3 — CID 63489637
5-chloro-N-ethyl-6-(ethylaminomethyl)-N-(2-ethylbutyl)pyridin-2-amine (PubChem CID 63489637) has the molecular formula C16H28ClN3 and a molecular weight of 297.87 g/mol. Its IUPAC name is 5-chloro-N-ethyl-6-(ethylaminomethyl)-N-(2-ethylbutyl)pyridin-2-amine.
| Compound Name | 5-chloro-N-ethyl-6-(ethylaminomethyl)-N-(2-ethylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63489637 |
| Molecular Formula | C16H28ClN3 |
| Molecular Weight | 297.87 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 5-chloro-N-ethyl-6-(ethylaminomethyl)-N-(2-ethylbutyl)pyridin-2-amine |
| SMILES | CCNCc1nc(N(CC)CC(CC)CC)ccc1Cl |
| InChI | InChI=1S/C16H28ClN3/c1-5-13(6-2)12-20(8-4)16-10-9-14(17)15(19-16)11-18-7-3/h9-10,13,18H,5-8,11-12H2,1-4H3 |
| InChIKey | VEQUQTRDEVSDIN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |