C17H31NO2 — CID 63490926
N-[[3-(octoxymethyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 63490926) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[[3-(octoxymethyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-(octoxymethyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63490926 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | N-[[3-(octoxymethyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCCCCCCOCc1ccoc1CNCCC |
| InChI | InChI=1S/C17H31NO2/c1-3-5-6-7-8-9-12-19-15-16-10-13-20-17(16)14-18-11-4-2/h10,13,18H,3-9,11-12,14-15H2,1-2H3 |
| InChIKey | URGHTLDXJGJLAP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|