C17H17IO2 — CID 63490949
2-(3,4-dimethylphenyl)-1-(5-iodo-2-methoxyphenyl)ethanone (PubChem CID 63490949) has the molecular formula C17H17IO2 and a molecular weight of 380.23 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-1-(5-iodo-2-methoxyphenyl)ethanone.
| Compound Name | 2-(3,4-dimethylphenyl)-1-(5-iodo-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 63490949 |
| Molecular Formula | C17H17IO2 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-1-(5-iodo-2-methoxyphenyl)ethanone |
| SMILES | COc1ccc(I)cc1C(=O)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H17IO2/c1-11-4-5-13(8-12(11)2)9-16(19)15-10-14(18)6-7-17(15)20-3/h4-8,10H,9H2,1-3H3 |
| InChIKey | XBIAXWWMQJCJQQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|