C24H24O8 — CID 634912
tetramethyl tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,6,11,12-tetracarboxylate (PubChem CID 634912) has the molecular formula C24H24O8 and a molecular weight of 440.45 g/mol. Its IUPAC name is tetramethyl tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,6,11,12-tetracarboxylate.
| Compound Name | tetramethyl tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,6,11,12-tetracarboxylate |
|---|---|
| PubChem CID | 634912 |
| Molecular Formula | C24H24O8 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | tetramethyl tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,6,11,12-tetracarboxylate |
| SMILES | COC(=O)c1c2ccc(c1C(=O)OC)CCc1ccc(c(C(=O)OC)c1C(=O)OC)CC2 |
| InChI | InChI=1S/C24H24O8/c1-29-21(25)17-13-5-6-14(18(17)22(26)30-2)11-12-16-8-7-15(10-9-13)19(23(27)31-3)20(16)24(28)32-4/h5-8H,9-12H2,1-4H3 |
| InChIKey | ZUYBKGPVJPHPTM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|