C15H16Cl3NO2 — CID 63491815
N-[[5-[(2,4,5-trichlorophenoxy)methyl]furan-2-yl]methyl]propan-1-amine (PubChem CID 63491815) has the molecular formula C15H16Cl3NO2 and a molecular weight of 348.66 g/mol. Its IUPAC name is N-[[5-[(2,4,5-trichlorophenoxy)methyl]furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-[(2,4,5-trichlorophenoxy)methyl]furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63491815 |
| Molecular Formula | C15H16Cl3NO2 |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | N-[[5-[(2,4,5-trichlorophenoxy)methyl]furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(COc2cc(Cl)c(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C15H16Cl3NO2/c1-2-5-19-8-10-3-4-11(21-10)9-20-15-7-13(17)12(16)6-14(15)18/h3-4,6-7,19H,2,5,8-9H2,1H3 |
| InChIKey | NHIKDULCWJNJSA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|