C13H9Br2ClFN — CID 63492584
2,4-dibromo-N-[(2-chloro-4-fluorophenyl)methyl]aniline (PubChem CID 63492584) has the molecular formula C13H9Br2ClFN and a molecular weight of 393.48 g/mol. Its IUPAC name is 2,4-dibromo-N-[(2-chloro-4-fluorophenyl)methyl]aniline.
| Compound Name | 2,4-dibromo-N-[(2-chloro-4-fluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 63492584 |
| Molecular Formula | C13H9Br2ClFN |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 390.88 |
| IUPAC Name | 2,4-dibromo-N-[(2-chloro-4-fluorophenyl)methyl]aniline |
| SMILES | Fc1ccc(CNc2ccc(Br)cc2Br)c(Cl)c1 |
| InChI | InChI=1S/C13H9Br2ClFN/c14-9-2-4-13(11(15)5-9)18-7-8-1-3-10(17)6-12(8)16/h1-6,18H,7H2 |
| InChIKey | PWCIGBXGGSORMK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |