C18H38N2 — CID 63494004
4-tert-butyl-N-methyl-2-[[methyl(pentan-2-yl)amino]methyl]cyclohexan-1-amine (PubChem CID 63494004) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is 4-tert-butyl-N-methyl-2-[[methyl(pentan-2-yl)amino]methyl]cyclohexan-1-amine.
| Compound Name | 4-tert-butyl-N-methyl-2-[[methyl(pentan-2-yl)amino]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 63494004 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 4-tert-butyl-N-methyl-2-[[methyl(pentan-2-yl)amino]methyl]cyclohexan-1-amine |
| SMILES | CCCC(C)N(C)CC1CC(C(C)(C)C)CCC1NC |
| InChI | InChI=1S/C18H38N2/c1-8-9-14(2)20(7)13-15-12-16(18(3,4)5)10-11-17(15)19-6/h14-17,19H,8-13H2,1-7H3 |
| InChIKey | AYQJKONOGJSYDM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |