C16H27ClN2S — CID 63494041
N-[[1-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]cyclohexyl]methyl]ethanamine (PubChem CID 63494041) has the molecular formula C16H27ClN2S and a molecular weight of 314.93 g/mol. Its IUPAC name is N-[[1-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]cyclohexyl]methyl]ethanamine.
| Compound Name | N-[[1-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63494041 |
| Molecular Formula | C16H27ClN2S |
| Molecular Weight | 314.93 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[[1-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]cyclohexyl]methyl]ethanamine |
| SMILES | CCNCC1(CN(C)Cc2ccc(Cl)s2)CCCCC1 |
| InChI | InChI=1S/C16H27ClN2S/c1-3-18-12-16(9-5-4-6-10-16)13-19(2)11-14-7-8-15(17)20-14/h7-8,18H,3-6,9-13H2,1-2H3 |
| InChIKey | HWDIGCJPGBQCOJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |