About N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine
N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine (PubChem CID 63494639) has the molecular formula C19H32N2
and a molecular weight of 288.48 g/mol. Its IUPAC name is N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine |
| PubChem CID | 63494639 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine |
| SMILES | CCNC1CCCCCC1CN(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C19H32N2/c1-5-20-18-10-8-6-7-9-17(18)14-21(4)19-12-11-15(2)13-16(19)3/h11-13,17-18,20H,5-10,14H2,1-4H3 |
| InChIKey | MESLWROOWVTCKL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine?
The IUPAC name of N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine (CID 63494639) is N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine.
What is the SMILES notation for N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine?
The canonical SMILES for N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine is CCNC1CCCCCC1CN(C)c1ccc(C)cc1C.
What is the InChIKey of N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine?
The InChIKey is MESLWROOWVTCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2/c1-5-20-18-10-8-6-7-9-17(18)14-21(4)19-12-11-15(2)13-16(19)3/h11-13,17-18,20H,5-10,14H2,1-4H3.
What are the key properties of N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine?
N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine has a molecular weight of 288.48 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-[(N,2,4-trimethylanilino)methyl]cycloheptan-1-amine is sourced from PubChem (CID 63494639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).