C18H31ClN2 — CID 63494918
N-[1-(3-chlorophenyl)ethyl]-2-ethyl-N,2-dimethyl-N'-propylpropane-1,3-diamine (PubChem CID 63494918) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-2-ethyl-N,2-dimethyl-N'-propylpropane-1,3-diamine.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-2-ethyl-N,2-dimethyl-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63494918 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-2-ethyl-N,2-dimethyl-N'-propylpropane-1,3-diamine |
| SMILES | CCCNCC(C)(CC)CN(C)C(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H31ClN2/c1-6-11-20-13-18(4,7-2)14-21(5)15(3)16-9-8-10-17(19)12-16/h8-10,12,15,20H,6-7,11,13-14H2,1-5H3 |
| InChIKey | NRASZXZQMKAYBW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|