C18H38N2 — CID 63494958
N,3,3-trimethyl-N-[[1-(propylaminomethyl)cyclohexyl]methyl]butan-2-amine (PubChem CID 63494958) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is N,3,3-trimethyl-N-[[1-(propylaminomethyl)cyclohexyl]methyl]butan-2-amine.
| Compound Name | N,3,3-trimethyl-N-[[1-(propylaminomethyl)cyclohexyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 63494958 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | N,3,3-trimethyl-N-[[1-(propylaminomethyl)cyclohexyl]methyl]butan-2-amine |
| SMILES | CCCNCC1(CN(C)C(C)C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C18H38N2/c1-7-13-19-14-18(11-9-8-10-12-18)15-20(6)16(2)17(3,4)5/h16,19H,7-15H2,1-6H3 |
| InChIKey | XESXLILEZRDIFT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|