About N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine
N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine (PubChem CID 63495185) has the molecular formula C19H34N2
and a molecular weight of 290.50 g/mol. Its IUPAC name is N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine |
| PubChem CID | 63495185 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine |
| SMILES | CCCC(C)(CNC(C)(C)C)CN(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H34N2/c1-8-13-19(6,14-20-18(3,4)5)15-21(7)17-11-9-16(2)10-12-17/h9-12,20H,8,13-15H2,1-7H3 |
| InChIKey | CAQFRJMOVJVFRR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine?
The IUPAC name of N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine (CID 63495185) is N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine.
What is the SMILES notation for N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine?
The canonical SMILES for N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine is CCCC(C)(CNC(C)(C)C)CN(C)c1ccc(C)cc1.
What is the InChIKey of N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine?
The InChIKey is CAQFRJMOVJVFRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34N2/c1-8-13-19(6,14-20-18(3,4)5)15-21(7)17-11-9-16(2)10-12-17/h9-12,20H,8,13-15H2,1-7H3.
What are the key properties of N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine?
N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine has a molecular weight of 290.50 g/mol, XLogP of 4.63, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N',2-dimethyl-N'-(4-methylphenyl)-2-propylpropane-1,3-diamine is sourced from PubChem (CID 63495185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).