C10H7Br3N2O3 — CID 634957
5-bromo-1-(3,5-dibromo-4-hydroxyphenyl)-1,3-diazinane-2,4-dione (PubChem CID 634957) has the molecular formula C10H7Br3N2O3 and a molecular weight of 442.89 g/mol. Its IUPAC name is 5-bromo-1-(3,5-dibromo-4-hydroxyphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 5-bromo-1-(3,5-dibromo-4-hydroxyphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 634957 |
| Molecular Formula | C10H7Br3N2O3 |
| Molecular Weight | 442.89 g/mol |
| Exact Mass | 439.80 |
| IUPAC Name | 5-bromo-1-(3,5-dibromo-4-hydroxyphenyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)N(c2cc(Br)c(O)c(Br)c2)CC1Br |
| InChI | InChI=1S/C10H7Br3N2O3/c11-5-1-4(2-6(12)8(5)16)15-3-7(13)9(17)14-10(15)18/h1-2,7,16H,3H2,(H,14,17,18) |
| InChIKey | MMOAGXLXRZDVSR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.89 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|