C21H29N — CID 63496197
2-benzyl-3-(2-methylphenyl)-N-(2-methylpropyl)propan-1-amine (PubChem CID 63496197) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is 2-benzyl-3-(2-methylphenyl)-N-(2-methylpropyl)propan-1-amine.
| Compound Name | 2-benzyl-3-(2-methylphenyl)-N-(2-methylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 63496197 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-benzyl-3-(2-methylphenyl)-N-(2-methylpropyl)propan-1-amine |
| SMILES | Cc1ccccc1CC(CNCC(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C21H29N/c1-17(2)15-22-16-20(13-19-10-5-4-6-11-19)14-21-12-8-7-9-18(21)3/h4-12,17,20,22H,13-16H2,1-3H3 |
| InChIKey | AZVWYHUDUHWULF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |