C18H21N3 — CID 63496499
1-(2,3-dimethylphenyl)-2-propan-2-ylbenzimidazol-5-amine (PubChem CID 63496499) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-2-propan-2-ylbenzimidazol-5-amine.
| Compound Name | 1-(2,3-dimethylphenyl)-2-propan-2-ylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 63496499 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-2-propan-2-ylbenzimidazol-5-amine |
| SMILES | Cc1cccc(-n2c(C(C)C)nc3cc(N)ccc32)c1C |
| InChI | InChI=1S/C18H21N3/c1-11(2)18-20-15-10-14(19)8-9-17(15)21(18)16-7-5-6-12(3)13(16)4/h5-11H,19H2,1-4H3 |
| InChIKey | ZAMNYVDTAFRURI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|