About 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline
2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline (PubChem CID 63496793) has the molecular formula C14H5BrCl4N2
and a molecular weight of 422.92 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline.
Molecular Properties
| Compound Name | 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline |
| PubChem CID | 63496793 |
| Molecular Formula | C14H5BrCl4N2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 419.84 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline |
| SMILES | Clc1cc(Cl)c2nc(-c3ccc(Br)cc3Cl)nc(Cl)c2c1 |
| InChI | InChI=1S/C14H5BrCl4N2/c15-6-1-2-8(10(17)3-6)14-20-12-9(13(19)21-14)4-7(16)5-11(12)18/h1-5H |
| InChIKey | XEISGEBQAMMXKQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline?
The IUPAC name of 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline (CID 63496793) is 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline.
What is the SMILES notation for 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline?
The canonical SMILES for 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline is Clc1cc(Cl)c2nc(-c3ccc(Br)cc3Cl)nc(Cl)c2c1.
What is the InChIKey of 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline?
The InChIKey is XEISGEBQAMMXKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H5BrCl4N2/c15-6-1-2-8(10(17)3-6)14-20-12-9(13(19)21-14)4-7(16)5-11(12)18/h1-5H.
What are the key properties of 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline?
2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline has a molecular weight of 422.92 g/mol, XLogP of 6.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2-chlorophenyl)-4,6,8-trichloroquinazoline is sourced from PubChem (CID 63496793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).