C17H22INO2 — CID 63498603
N-[[4-[(3-iodophenoxy)methyl]-5-methylfuran-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 63498603) has the molecular formula C17H22INO2 and a molecular weight of 399.27 g/mol. Its IUPAC name is N-[[4-[(3-iodophenoxy)methyl]-5-methylfuran-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-[(3-iodophenoxy)methyl]-5-methylfuran-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63498603 |
| Molecular Formula | C17H22INO2 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-[[4-[(3-iodophenoxy)methyl]-5-methylfuran-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | Cc1oc(CNC(C)(C)C)cc1COc1cccc(I)c1 |
| InChI | InChI=1S/C17H22INO2/c1-12-13(8-16(21-12)10-19-17(2,3)4)11-20-15-7-5-6-14(18)9-15/h5-9,19H,10-11H2,1-4H3 |
| InChIKey | OPVBIIXUFYVPBW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|