C18H30N2 — CID 63503034
N'-benzyl-N-(cyclohexylmethyl)-N'-ethylethane-1,2-diamine (PubChem CID 63503034) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N'-benzyl-N-(cyclohexylmethyl)-N'-ethylethane-1,2-diamine.
| Compound Name | N'-benzyl-N-(cyclohexylmethyl)-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63503034 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N'-benzyl-N-(cyclohexylmethyl)-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCNCC1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C18H30N2/c1-2-20(16-18-11-7-4-8-12-18)14-13-19-15-17-9-5-3-6-10-17/h4,7-8,11-12,17,19H,2-3,5-6,9-10,13-16H2,1H3 |
| InChIKey | MMDLWOIYXDMWSW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|