C16H27BrN2 — CID 63503088
2-N-[(2-bromophenyl)methyl]-2-N-methyl-1-N-pentylpropane-1,2-diamine (PubChem CID 63503088) has the molecular formula C16H27BrN2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-N-[(2-bromophenyl)methyl]-2-N-methyl-1-N-pentylpropane-1,2-diamine.
| Compound Name | 2-N-[(2-bromophenyl)methyl]-2-N-methyl-1-N-pentylpropane-1,2-diamine |
|---|---|
| PubChem CID | 63503088 |
| Molecular Formula | C16H27BrN2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-N-[(2-bromophenyl)methyl]-2-N-methyl-1-N-pentylpropane-1,2-diamine |
| SMILES | CCCCCNCC(C)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C16H27BrN2/c1-4-5-8-11-18-12-14(2)19(3)13-15-9-6-7-10-16(15)17/h6-7,9-10,14,18H,4-5,8,11-13H2,1-3H3 |
| InChIKey | ABGAIAFBEFRIJY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|