C20H16Cl4O4 — CID 635039
3,4,5,6-tetrachloro-1,8,15,16-tetramethoxytetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13,15-heptaene (PubChem CID 635039) has the molecular formula C20H16Cl4O4 and a molecular weight of 462.16 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-1,8,15,16-tetramethoxytetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13,15-heptaene.
| Compound Name | 3,4,5,6-tetrachloro-1,8,15,16-tetramethoxytetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13,15-heptaene |
|---|---|
| PubChem CID | 635039 |
| Molecular Formula | C20H16Cl4O4 |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 3,4,5,6-tetrachloro-1,8,15,16-tetramethoxytetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13,15-heptaene |
| SMILES | COC1=C(OC)C2(OC)c3ccccc3C1(OC)c1c(Cl)c(Cl)c(Cl)c(Cl)c12 |
| InChI | InChI=1S/C20H16Cl4O4/c1-25-17-18(26-2)20(28-4)10-8-6-5-7-9(10)19(17,27-3)11-12(20)14(22)16(24)15(23)13(11)21/h5-8H,1-4H3 |
| InChIKey | RLQFWCNCFHDXBY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|