About N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine
N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine (PubChem CID 63504001) has the molecular formula C16H27ClN2O
and a molecular weight of 298.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine |
| PubChem CID | 63504001 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine |
| SMILES | CCC(CC)N(CCNc1ccccc1Cl)CCOC |
| InChI | InChI=1S/C16H27ClN2O/c1-4-14(5-2)19(12-13-20-3)11-10-18-16-9-7-6-8-15(16)17/h6-9,14,18H,4-5,10-13H2,1-3H3 |
| InChIKey | ISHUAIGCJMOWIW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine?
The IUPAC name of N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine (CID 63504001) is N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine.
What is the SMILES notation for N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine?
The canonical SMILES for N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine is CCC(CC)N(CCNc1ccccc1Cl)CCOC.
What is the InChIKey of N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine?
The InChIKey is ISHUAIGCJMOWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27ClN2O/c1-4-14(5-2)19(12-13-20-3)11-10-18-16-9-7-6-8-15(16)17/h6-9,14,18H,4-5,10-13H2,1-3H3.
What are the key properties of N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine?
N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine has a molecular weight of 298.86 g/mol, XLogP of 3.89, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-N'-(2-methoxyethyl)-N'-pentan-3-ylethane-1,2-diamine is sourced from PubChem (CID 63504001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).