About N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine
N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine (PubChem CID 63507085) has the molecular formula C16H35N
and a molecular weight of 241.46 g/mol. Its IUPAC name is N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine |
| PubChem CID | 63507085 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine |
| SMILES | CCC(CC)(CCC(C)(C)C)CNC(C)(C)C |
| InChI | InChI=1S/C16H35N/c1-9-16(10-2,12-11-14(3,4)5)13-17-15(6,7)8/h17H,9-13H2,1-8H3 |
| InChIKey | AFUBYFIYEPBIOK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine?
The IUPAC name of N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine (CID 63507085) is N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine.
What is the SMILES notation for N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine?
The canonical SMILES for N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine is CCC(CC)(CCC(C)(C)C)CNC(C)(C)C.
What is the InChIKey of N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine?
The InChIKey is AFUBYFIYEPBIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35N/c1-9-16(10-2,12-11-14(3,4)5)13-17-15(6,7)8/h17H,9-13H2,1-8H3.
What are the key properties of N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine?
N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine has a molecular weight of 241.46 g/mol, XLogP of 5.01, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-diethyl-5,5-dimethylhexan-1-amine is sourced from PubChem (CID 63507085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).