C16H17BrClNO — CID 63507981
1-(5-bromo-2-ethoxyphenyl)-2-(3-chlorophenyl)ethanamine (PubChem CID 63507981) has the molecular formula C16H17BrClNO and a molecular weight of 354.68 g/mol. Its IUPAC name is 1-(5-bromo-2-ethoxyphenyl)-2-(3-chlorophenyl)ethanamine.
| Compound Name | 1-(5-bromo-2-ethoxyphenyl)-2-(3-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 63507981 |
| Molecular Formula | C16H17BrClNO |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 1-(5-bromo-2-ethoxyphenyl)-2-(3-chlorophenyl)ethanamine |
| SMILES | CCOc1ccc(Br)cc1C(N)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17BrClNO/c1-2-20-16-7-6-12(17)10-14(16)15(19)9-11-4-3-5-13(18)8-11/h3-8,10,15H,2,9,19H2,1H3 |
| InChIKey | BYGAHCRBSCCRNW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |