About N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine
N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine (PubChem CID 63507984) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine |
| PubChem CID | 63507984 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine |
| SMILES | CNCC1(Cc2c(C)cc(C)cc2C)CCCCC1 |
| InChI | InChI=1S/C18H29N/c1-14-10-15(2)17(16(3)11-14)12-18(13-19-4)8-6-5-7-9-18/h10-11,19H,5-9,12-13H2,1-4H3 |
| InChIKey | MYVMUFQXVHYXDQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine?
The IUPAC name of N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine (CID 63507984) is N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine.
What is the SMILES notation for N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine?
The canonical SMILES for N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine is CNCC1(Cc2c(C)cc(C)cc2C)CCCCC1.
What is the InChIKey of N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine?
The InChIKey is MYVMUFQXVHYXDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N/c1-14-10-15(2)17(16(3)11-14)12-18(13-19-4)8-6-5-7-9-18/h10-11,19H,5-9,12-13H2,1-4H3.
What are the key properties of N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine?
N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine has a molecular weight of 259.44 g/mol, XLogP of 4.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[1-[(2,4,6-trimethylphenyl)methyl]cyclohexyl]methanamine is sourced from PubChem (CID 63507984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).