C19H32FN — CID 63508094
N-tert-butyl-2-ethyl-2-[(2-fluorophenyl)methyl]hexan-1-amine (PubChem CID 63508094) has the molecular formula C19H32FN and a molecular weight of 293.47 g/mol. Its IUPAC name is N-tert-butyl-2-ethyl-2-[(2-fluorophenyl)methyl]hexan-1-amine.
| Compound Name | N-tert-butyl-2-ethyl-2-[(2-fluorophenyl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 63508094 |
| Molecular Formula | C19H32FN |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N-tert-butyl-2-ethyl-2-[(2-fluorophenyl)methyl]hexan-1-amine |
| SMILES | CCCCC(CC)(CNC(C)(C)C)Cc1ccccc1F |
| InChI | InChI=1S/C19H32FN/c1-6-8-13-19(7-2,15-21-18(3,4)5)14-16-11-9-10-12-17(16)20/h9-12,21H,6-8,13-15H2,1-5H3 |
| InChIKey | BDCWISOHRUUMRJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |