C18H31NO — CID 63508115
2,2-diethyl-N-(2-methylpropyl)-4-phenoxybutan-1-amine (PubChem CID 63508115) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 2,2-diethyl-N-(2-methylpropyl)-4-phenoxybutan-1-amine.
| Compound Name | 2,2-diethyl-N-(2-methylpropyl)-4-phenoxybutan-1-amine |
|---|---|
| PubChem CID | 63508115 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 2,2-diethyl-N-(2-methylpropyl)-4-phenoxybutan-1-amine |
| SMILES | CCC(CC)(CCOc1ccccc1)CNCC(C)C |
| InChI | InChI=1S/C18H31NO/c1-5-18(6-2,15-19-14-16(3)4)12-13-20-17-10-8-7-9-11-17/h7-11,16,19H,5-6,12-15H2,1-4H3 |
| InChIKey | NNOXDOZSTSZEBK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |