C16H16Br3N — CID 63508792
2-(3-bromophenyl)-1-(2,5-dibromophenyl)-N-ethylethanamine (PubChem CID 63508792) has the molecular formula C16H16Br3N and a molecular weight of 462.02 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(2,5-dibromophenyl)-N-ethylethanamine.
| Compound Name | 2-(3-bromophenyl)-1-(2,5-dibromophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 63508792 |
| Molecular Formula | C16H16Br3N |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 458.88 |
| IUPAC Name | 2-(3-bromophenyl)-1-(2,5-dibromophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cccc(Br)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H16Br3N/c1-2-20-16(9-11-4-3-5-12(17)8-11)14-10-13(18)6-7-15(14)19/h3-8,10,16,20H,2,9H2,1H3 |
| InChIKey | YBCIPPSSKXYOOS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |