C19H24FN — CID 63509375
1-(5-fluoro-2-methylphenyl)-N-methyl-1-[4-(2-methylpropyl)phenyl]methanamine (PubChem CID 63509375) has the molecular formula C19H24FN and a molecular weight of 285.41 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-N-methyl-1-[4-(2-methylpropyl)phenyl]methanamine.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-N-methyl-1-[4-(2-methylpropyl)phenyl]methanamine |
|---|---|
| PubChem CID | 63509375 |
| Molecular Formula | C19H24FN |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-N-methyl-1-[4-(2-methylpropyl)phenyl]methanamine |
| SMILES | CNC(c1ccc(CC(C)C)cc1)c1cc(F)ccc1C |
| InChI | InChI=1S/C19H24FN/c1-13(2)11-15-6-8-16(9-7-15)19(21-4)18-12-17(20)10-5-14(18)3/h5-10,12-13,19,21H,11H2,1-4H3 |
| InChIKey | BMKBKBLSAQCYSB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |