About N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine
N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine (PubChem CID 63510430) has the molecular formula C18H29F2N
and a molecular weight of 297.43 g/mol. Its IUPAC name is N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine |
| PubChem CID | 63510430 |
| Molecular Formula | C18H29F2N |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine |
| SMILES | CCCC(CCC)(CNC(C)(C)C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H29F2N/c1-6-8-18(9-7-2,13-21-17(3,4)5)14-10-15(19)12-16(20)11-14/h10-12,21H,6-9,13H2,1-5H3 |
| InChIKey | XYYDEGXPPJJAMA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine?
The IUPAC name of N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine (CID 63510430) is N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine.
What is the SMILES notation for N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine?
The canonical SMILES for N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine is CCCC(CCC)(CNC(C)(C)C)c1cc(F)cc(F)c1.
What is the InChIKey of N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine?
The InChIKey is XYYDEGXPPJJAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29F2N/c1-6-8-18(9-7-2,13-21-17(3,4)5)14-10-15(19)12-16(20)11-14/h10-12,21H,6-9,13H2,1-5H3.
What are the key properties of N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine?
N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine has a molecular weight of 297.43 g/mol, XLogP of 5.19, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(3,5-difluorophenyl)-2-propylpentan-1-amine is sourced from PubChem (CID 63510430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).