C18H31N — CID 63510909
2-(3-methylphenyl)-N,2-dipropylpentan-1-amine (PubChem CID 63510909) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N,2-dipropylpentan-1-amine.
| Compound Name | 2-(3-methylphenyl)-N,2-dipropylpentan-1-amine |
|---|---|
| PubChem CID | 63510909 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-(3-methylphenyl)-N,2-dipropylpentan-1-amine |
| SMILES | CCCNCC(CCC)(CCC)c1cccc(C)c1 |
| InChI | InChI=1S/C18H31N/c1-5-11-18(12-6-2,15-19-13-7-3)17-10-8-9-16(4)14-17/h8-10,14,19H,5-7,11-13,15H2,1-4H3 |
| InChIKey | SCVRMZOFHCLXMF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|