About 4-(2-bromocyclopentyl)-1,2-dimethylbenzene
4-(2-bromocyclopentyl)-1,2-dimethylbenzene (PubChem CID 63511139) has the molecular formula C13H17Br
and a molecular weight of 253.18 g/mol. Its IUPAC name is 4-(2-bromocyclopentyl)-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-(2-bromocyclopentyl)-1,2-dimethylbenzene |
| PubChem CID | 63511139 |
| Molecular Formula | C13H17Br |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-(2-bromocyclopentyl)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C2CCCC2Br)cc1C |
| InChI | InChI=1S/C13H17Br/c1-9-6-7-11(8-10(9)2)12-4-3-5-13(12)14/h6-8,12-13H,3-5H2,1-2H3 |
| InChIKey | JBPURKOKUZJDLS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromocyclopentyl)-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromocyclopentyl)-1,2-dimethylbenzene?
The IUPAC name of 4-(2-bromocyclopentyl)-1,2-dimethylbenzene (CID 63511139) is 4-(2-bromocyclopentyl)-1,2-dimethylbenzene.
What is the SMILES notation for 4-(2-bromocyclopentyl)-1,2-dimethylbenzene?
The canonical SMILES for 4-(2-bromocyclopentyl)-1,2-dimethylbenzene is Cc1ccc(C2CCCC2Br)cc1C.
What is the InChIKey of 4-(2-bromocyclopentyl)-1,2-dimethylbenzene?
The InChIKey is JBPURKOKUZJDLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Br/c1-9-6-7-11(8-10(9)2)12-4-3-5-13(12)14/h6-8,12-13H,3-5H2,1-2H3.
What are the key properties of 4-(2-bromocyclopentyl)-1,2-dimethylbenzene?
4-(2-bromocyclopentyl)-1,2-dimethylbenzene has a molecular weight of 253.18 g/mol, XLogP of 4.33, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromocyclopentyl)-1,2-dimethylbenzene is sourced from PubChem (CID 63511139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).